C12H19N5OS — CID 80829806
3-[2-methoxyethyl-[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile (PubChem CID 80829806) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[2-methoxyethyl-[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[2-methoxyethyl-[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 80829806 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[2-methoxyethyl-[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile |
| SMILES | CNc1cc(N(CCC#N)CCOC)nc(SC)n1 |
| InChI | InChI=1S/C12H19N5OS/c1-14-10-9-11(16-12(15-10)19-3)17(6-4-5-13)7-8-18-2/h9H,4,6-8H2,1-3H3,(H,14,15,16) |
| InChIKey | FMWMTESKGHZFQD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |