C12H21ClN4O2 — CID 80810389
1-[[5-chloro-2-(propylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 80810389) has the molecular formula C12H21ClN4O2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 1-[[5-chloro-2-(propylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[5-chloro-2-(propylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 80810389 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[[5-chloro-2-(propylamino)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | CCCNc1ncc(Cl)c(N(C)CC(O)COC)n1 |
| InChI | InChI=1S/C12H21ClN4O2/c1-4-5-14-12-15-6-10(13)11(16-12)17(2)7-9(18)8-19-3/h6,9,18H,4-5,7-8H2,1-3H3,(H,14,15,16) |
| InChIKey | GCBBPXROBPFRMP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |