C12H24N6 — CID 80810743
2-N,4-N,4-N-trimethyl-2-N-(4-methylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80810743) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is 2-N,4-N,4-N-trimethyl-2-N-(4-methylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N-trimethyl-2-N-(4-methylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80810743 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-N,4-N,4-N-trimethyl-2-N-(4-methylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)CC(C)N(C)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H24N6/c1-8(2)7-9(3)18(6)12-15-10(13)14-11(16-12)17(4)5/h8-9H,7H2,1-6H3,(H2,13,14,15,16) |
| InChIKey | CIVYVVJCMNQOCV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |