C13H20N6S — CID 80849728
2-N,4-N,4-N-trimethyl-2-N-(1-thiophen-2-ylpropan-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80849728) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-N,4-N,4-N-trimethyl-2-N-(1-thiophen-2-ylpropan-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N-trimethyl-2-N-(1-thiophen-2-ylpropan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80849728 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-N,4-N,4-N-trimethyl-2-N-(1-thiophen-2-ylpropan-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(Cc1cccs1)N(C)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H20N6S/c1-9(8-10-6-5-7-20-10)19(4)13-16-11(14)15-12(17-13)18(2)3/h5-7,9H,8H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | XQDUIMYCVWGDAV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |