C13H23N5O2S — CID 80810895
N-methyl-6-(4-methylsulfonylpiperazin-1-yl)-5-propylpyrimidin-4-amine (PubChem CID 80810895) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is N-methyl-6-(4-methylsulfonylpiperazin-1-yl)-5-propylpyrimidin-4-amine.
| Compound Name | N-methyl-6-(4-methylsulfonylpiperazin-1-yl)-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80810895 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-methyl-6-(4-methylsulfonylpiperazin-1-yl)-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(NC)ncnc1N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H23N5O2S/c1-4-5-11-12(14-2)15-10-16-13(11)17-6-8-18(9-7-17)21(3,19)20/h10H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | IAQASTUVTNYFFQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |