C13H21FN4O — CID 80810933
2-[cyclohexyl-[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]ethanol (PubChem CID 80810933) has the molecular formula C13H21FN4O and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-[cyclohexyl-[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[cyclohexyl-[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 80810933 |
| Molecular Formula | C13H21FN4O |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[cyclohexyl-[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]ethanol |
| SMILES | CNc1ncc(F)c(N(CCO)C2CCCCC2)n1 |
| InChI | InChI=1S/C13H21FN4O/c1-15-13-16-9-11(14)12(17-13)18(7-8-19)10-5-3-2-4-6-10/h9-10,19H,2-8H2,1H3,(H,15,16,17) |
| InChIKey | ITWIHLBDYVMUJI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |