C14H23ClN4O — CID 80811147
2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]-cyclohexylamino]ethanol (PubChem CID 80811147) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]-cyclohexylamino]ethanol.
| Compound Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]-cyclohexylamino]ethanol |
|---|---|
| PubChem CID | 80811147 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]-cyclohexylamino]ethanol |
| SMILES | CCNc1ncc(Cl)c(N(CCO)C2CCCCC2)n1 |
| InChI | InChI=1S/C14H23ClN4O/c1-2-16-14-17-10-12(15)13(18-14)19(8-9-20)11-6-4-3-5-7-11/h10-11,20H,2-9H2,1H3,(H,16,17,18) |
| InChIKey | SMPRPABBQLGHNF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |