C12H17FN4O — CID 80812809
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoro-N-methylpyrimidin-2-amine (PubChem CID 80812809) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoro-N-methylpyrimidin-2-amine.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoro-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80812809 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoro-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C12H17FN4O/c1-14-12-15-7-8(13)11(16-12)17-5-6-18-10-4-2-3-9(10)17/h7,9-10H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | ZCNWNBYLYKBZPW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |