C14H18ClNO2 — CID 808142
2-(4-chloro-3,5-dimethylphenoxy)-1-pyrrolidin-1-ylethanone (PubChem CID 808142) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 808142 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1cc(OCC(=O)N2CCCC2)cc(C)c1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-10-7-12(8-11(2)14(10)15)18-9-13(17)16-5-3-4-6-16/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | HGSAUDKDAPIOMC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |