C12H18N4O — CID 80817247
3-[[6-(ethylamino)-2-pyridinyl]amino]piperidin-2-one (PubChem CID 80817247) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[[6-(ethylamino)-2-pyridinyl]amino]piperidin-2-one.
| Compound Name | 3-[[6-(ethylamino)-2-pyridinyl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 80817247 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-[[6-(ethylamino)-2-pyridinyl]amino]piperidin-2-one |
| SMILES | CCNc1cccc(NC2CCCNC2=O)n1 |
| InChI | InChI=1S/C12H18N4O/c1-2-13-10-6-3-7-11(16-10)15-9-5-4-8-14-12(9)17/h3,6-7,9H,2,4-5,8H2,1H3,(H,14,17)(H2,13,15,16) |
| InChIKey | CCTVBHWXONSOQZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |