C13H24N4 — CID 80818385
6-N-ethyl-4-N-hexan-3-yl-5-methylpyrimidine-4,6-diamine (PubChem CID 80818385) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 6-N-ethyl-4-N-hexan-3-yl-5-methylpyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-hexan-3-yl-5-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80818385 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 6-N-ethyl-4-N-hexan-3-yl-5-methylpyrimidine-4,6-diamine |
| SMILES | CCCC(CC)Nc1ncnc(NCC)c1C |
| InChI | InChI=1S/C13H24N4/c1-5-8-11(6-2)17-13-10(4)12(14-7-3)15-9-16-13/h9,11H,5-8H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | PKPCOFTXALHUAJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |