C12H22N4 — CID 80821693
4-N-hexan-3-yl-6-N,5-dimethylpyrimidine-4,6-diamine (PubChem CID 80821693) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-N-hexan-3-yl-6-N,5-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-hexan-3-yl-6-N,5-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80821693 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 4-N-hexan-3-yl-6-N,5-dimethylpyrimidine-4,6-diamine |
| SMILES | CCCC(CC)Nc1ncnc(NC)c1C |
| InChI | InChI=1S/C12H22N4/c1-5-7-10(6-2)16-12-9(3)11(13-4)14-8-15-12/h8,10H,5-7H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | MMEQIZKKPYTTBM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |