C10H18N4O — CID 83179964
3-[[5-methyl-6-(methylamino)pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 83179964) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-[[5-methyl-6-(methylamino)pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 3-[[5-methyl-6-(methylamino)pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 83179964 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-[[5-methyl-6-(methylamino)pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CNc1ncnc(NC(C)CCO)c1C |
| InChI | InChI=1S/C10H18N4O/c1-7(4-5-15)14-10-8(2)9(11-3)12-6-13-10/h6-7,15H,4-5H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | JDYQFEZXXBQYRC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |