C12H21N5OS — CID 80820634
2-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]-(2-methylpropyl)amino]acetamide (PubChem CID 80820634) has the molecular formula C12H21N5OS and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 80820634 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]-(2-methylpropyl)amino]acetamide |
| SMILES | CNc1cc(N(CC(N)=O)CC(C)C)nc(SC)n1 |
| InChI | InChI=1S/C12H21N5OS/c1-8(2)6-17(7-9(13)18)11-5-10(14-3)15-12(16-11)19-4/h5,8H,6-7H2,1-4H3,(H2,13,18)(H,14,15,16) |
| InChIKey | OHCYJHVMUBZYJF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |