C10H18N6O — CID 80901634
2-[(2-hydrazinylpyrimidin-4-yl)-(2-methylpropyl)amino]acetamide (PubChem CID 80901634) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(2-hydrazinylpyrimidin-4-yl)-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[(2-hydrazinylpyrimidin-4-yl)-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 80901634 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[(2-hydrazinylpyrimidin-4-yl)-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)c1ccnc(NN)n1 |
| InChI | InChI=1S/C10H18N6O/c1-7(2)5-16(6-8(11)17)9-3-4-13-10(14-9)15-12/h3-4,7H,5-6,12H2,1-2H3,(H2,11,17)(H,13,14,15) |
| InChIKey | WDGZKZLRYAIHFM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|