C11H21N5 — CID 80904714
2-hydrazinyl-N-(2-methylpropyl)-N-propan-2-ylpyrimidin-4-amine (PubChem CID 80904714) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-methylpropyl)-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(2-methylpropyl)-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80904714 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 2-hydrazinyl-N-(2-methylpropyl)-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)CN(c1ccnc(NN)n1)C(C)C |
| InChI | InChI=1S/C11H21N5/c1-8(2)7-16(9(3)4)10-5-6-13-11(14-10)15-12/h5-6,8-9H,7,12H2,1-4H3,(H,13,14,15) |
| InChIKey | HPWYRBKZDVDBHG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|