C12H24N6 — CID 80900495
N'-(2-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 80900495) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is N'-(2-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(2-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 80900495 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | N'-(2-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN(C)C)c1ccnc(NN)n1 |
| InChI | InChI=1S/C12H24N6/c1-10(2)9-18(8-7-17(3)4)11-5-6-14-12(15-11)16-13/h5-6,10H,7-9,13H2,1-4H3,(H,14,15,16) |
| InChIKey | SYSQURMBABELBH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|