C16H25N3O2 — CID 80821225
3-N-(1-cyclopentylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine (PubChem CID 80821225) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-N-(1-cyclopentylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine.
| Compound Name | 3-N-(1-cyclopentylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 80821225 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 3-N-(1-cyclopentylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine |
| SMILES | CCCNc1cccc(NC(C)C2CCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O2/c1-3-11-17-14-9-6-10-15(16(14)19(20)21)18-12(2)13-7-4-5-8-13/h6,9-10,12-13,17-18H,3-5,7-8,11H2,1-2H3 |
| InChIKey | MVUAYVQBZQNGDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|