C15H28N4 — CID 80822476
6-N-ethyl-4-N-hexan-2-yl-5-propylpyrimidine-4,6-diamine (PubChem CID 80822476) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is 6-N-ethyl-4-N-hexan-2-yl-5-propylpyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-hexan-2-yl-5-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80822476 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 6-N-ethyl-4-N-hexan-2-yl-5-propylpyrimidine-4,6-diamine |
| SMILES | CCCCC(C)Nc1ncnc(NCC)c1CCC |
| InChI | InChI=1S/C15H28N4/c1-5-8-10-12(4)19-15-13(9-6-2)14(16-7-3)17-11-18-15/h11-12H,5-10H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | DMNFECBRPHIECB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |