C14H22N6S — CID 80829137
4-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80829137) has the molecular formula C14H22N6S and a molecular weight of 306.44 g/mol. Its IUPAC name is 4-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80829137 |
| Molecular Formula | C14H22N6S |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)nc(NCc2cc(C)c(C)s2)n1 |
| InChI | InChI=1S/C14H22N6S/c1-5-20(6-2)14-18-12(15)17-13(19-14)16-8-11-7-9(3)10(4)21-11/h7H,5-6,8H2,1-4H3,(H3,15,16,17,18,19) |
| InChIKey | LWVFZWNQCFEJON-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |