C10H16FN5O2S — CID 80830868
5-fluoro-N-methyl-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 80830868) has the molecular formula C10H16FN5O2S and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-fluoro-N-methyl-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-methyl-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80830868 |
| Molecular Formula | C10H16FN5O2S |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-fluoro-N-methyl-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(N2CCN(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C10H16FN5O2S/c1-12-10-13-7-8(11)9(14-10)15-3-5-16(6-4-15)19(2,17)18/h7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | DNHXQVFCVVIACA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |