C9H14FN5O2S — CID 80830936
5-fluoro-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 80830936) has the molecular formula C9H14FN5O2S and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-fluoro-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80830936 |
| Molecular Formula | C9H14FN5O2S |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-fluoro-4-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCN(c2nc(N)ncc2F)CC1 |
| InChI | InChI=1S/C9H14FN5O2S/c1-18(16,17)15-4-2-14(3-5-15)8-7(10)6-12-9(11)13-8/h6H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | QBZPCUMEIGCRKW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |