C12H10ClN5 — CID 80840403
2-[(6-amino-5-methylpyrimidin-4-yl)amino]-4-chlorobenzonitrile (PubChem CID 80840403) has the molecular formula C12H10ClN5 and a molecular weight of 259.70 g/mol. Its IUPAC name is 2-[(6-amino-5-methylpyrimidin-4-yl)amino]-4-chlorobenzonitrile.
| Compound Name | 2-[(6-amino-5-methylpyrimidin-4-yl)amino]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 80840403 |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[(6-amino-5-methylpyrimidin-4-yl)amino]-4-chlorobenzonitrile |
| SMILES | Cc1c(N)ncnc1Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C12H10ClN5/c1-7-11(15)16-6-17-12(7)18-10-4-9(13)3-2-8(10)5-14/h2-4,6H,1H3,(H3,15,16,17,18) |
| InChIKey | DKKMKHUORJVSNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |