C14H14ClN5 — CID 80841839
2-[(6-amino-5-propan-2-ylpyrimidin-4-yl)amino]-4-chlorobenzonitrile (PubChem CID 80841839) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-[(6-amino-5-propan-2-ylpyrimidin-4-yl)amino]-4-chlorobenzonitrile.
| Compound Name | 2-[(6-amino-5-propan-2-ylpyrimidin-4-yl)amino]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 80841839 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[(6-amino-5-propan-2-ylpyrimidin-4-yl)amino]-4-chlorobenzonitrile |
| SMILES | CC(C)c1c(N)ncnc1Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C14H14ClN5/c1-8(2)12-13(17)18-7-19-14(12)20-11-5-10(15)4-3-9(11)6-16/h3-5,7-8H,1-2H3,(H3,17,18,19,20) |
| InChIKey | ITPKBAWZCGGSTE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |