C12H19FN4 — CID 80842364
4-(4,4-dimethylazepan-1-yl)-5-fluoropyrimidin-2-amine (PubChem CID 80842364) has the molecular formula C12H19FN4 and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-(4,4-dimethylazepan-1-yl)-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(4,4-dimethylazepan-1-yl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80842364 |
| Molecular Formula | C12H19FN4 |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 4-(4,4-dimethylazepan-1-yl)-5-fluoropyrimidin-2-amine |
| SMILES | CC1(C)CCCN(c2nc(N)ncc2F)CC1 |
| InChI | InChI=1S/C12H19FN4/c1-12(2)4-3-6-17(7-5-12)10-9(13)8-15-11(14)16-10/h8H,3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | GJISEYBTSMGTBP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |