C16H20ClN3O — CID 80844937
6-[(2-chlorophenyl)methoxy]-N-ethyl-5-propan-2-ylpyrimidin-4-amine (PubChem CID 80844937) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methoxy]-N-ethyl-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-[(2-chlorophenyl)methoxy]-N-ethyl-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80844937 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 6-[(2-chlorophenyl)methoxy]-N-ethyl-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(OCc2ccccc2Cl)c1C(C)C |
| InChI | InChI=1S/C16H20ClN3O/c1-4-18-15-14(11(2)3)16(20-10-19-15)21-9-12-7-5-6-8-13(12)17/h5-8,10-11H,4,9H2,1-3H3,(H,18,19,20) |
| InChIKey | GAVGUOKZGMCUBS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |