C15H18BrN3O — CID 82825929
6-[(2-bromophenyl)methoxy]-N,5-diethylpyrimidin-4-amine (PubChem CID 82825929) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 6-[(2-bromophenyl)methoxy]-N,5-diethylpyrimidin-4-amine.
| Compound Name | 6-[(2-bromophenyl)methoxy]-N,5-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82825929 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 6-[(2-bromophenyl)methoxy]-N,5-diethylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(OCc2ccccc2Br)c1CC |
| InChI | InChI=1S/C15H18BrN3O/c1-3-12-14(17-4-2)18-10-19-15(12)20-9-11-7-5-6-8-13(11)16/h5-8,10H,3-4,9H2,1-2H3,(H,17,18,19) |
| InChIKey | CDYHLMSGXJAWRQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |