C13H14BrN3O2 — CID 82826086
6-[(2-bromophenyl)methoxy]-5-methoxy-N-methylpyrimidin-4-amine (PubChem CID 82826086) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 6-[(2-bromophenyl)methoxy]-5-methoxy-N-methylpyrimidin-4-amine.
| Compound Name | 6-[(2-bromophenyl)methoxy]-5-methoxy-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82826086 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 6-[(2-bromophenyl)methoxy]-5-methoxy-N-methylpyrimidin-4-amine |
| SMILES | CNc1ncnc(OCc2ccccc2Br)c1OC |
| InChI | InChI=1S/C13H14BrN3O2/c1-15-12-11(18-2)13(17-8-16-12)19-7-9-5-3-4-6-10(9)14/h3-6,8H,7H2,1-2H3,(H,15,16,17) |
| InChIKey | QJANOTZYKRHSJN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |