C14H14N4S — CID 80847556
4-N-(1-benzothiophen-5-yl)-2-N-ethylpyrimidine-2,4-diamine (PubChem CID 80847556) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-N-(1-benzothiophen-5-yl)-2-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1-benzothiophen-5-yl)-2-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80847556 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-N-(1-benzothiophen-5-yl)-2-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1nccc(Nc2ccc3sccc3c2)n1 |
| InChI | InChI=1S/C14H14N4S/c1-2-15-14-16-7-5-13(18-14)17-11-3-4-12-10(9-11)6-8-19-12/h3-9H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | KZUGGSNKDPRJOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |