C15H16N4S — CID 80847555
2-N-(1-benzothiophen-5-yl)-6-N-propylpyrazine-2,6-diamine (PubChem CID 80847555) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 2-N-(1-benzothiophen-5-yl)-6-N-propylpyrazine-2,6-diamine.
| Compound Name | 2-N-(1-benzothiophen-5-yl)-6-N-propylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80847555 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-N-(1-benzothiophen-5-yl)-6-N-propylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(Nc2ccc3sccc3c2)n1 |
| InChI | InChI=1S/C15H16N4S/c1-2-6-17-14-9-16-10-15(19-14)18-12-3-4-13-11(8-12)5-7-20-13/h3-5,7-10H,2,6H2,1H3,(H2,17,18,19) |
| InChIKey | WYZMDXDQPTZXBO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |