C13H14ClFN4 — CID 80755290
2-N-(3-chloro-4-fluorophenyl)-6-N-propylpyrazine-2,6-diamine (PubChem CID 80755290) has the molecular formula C13H14ClFN4 and a molecular weight of 280.73 g/mol. Its IUPAC name is 2-N-(3-chloro-4-fluorophenyl)-6-N-propylpyrazine-2,6-diamine.
| Compound Name | 2-N-(3-chloro-4-fluorophenyl)-6-N-propylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80755290 |
| Molecular Formula | C13H14ClFN4 |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-N-(3-chloro-4-fluorophenyl)-6-N-propylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H14ClFN4/c1-2-5-17-12-7-16-8-13(19-12)18-9-3-4-11(15)10(14)6-9/h3-4,6-8H,2,5H2,1H3,(H2,17,18,19) |
| InChIKey | QOKSUEAYSZVUOM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |