C11H14N4S — CID 80851429
6-N-propyl-2-N-thiophen-3-ylpyrazine-2,6-diamine (PubChem CID 80851429) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 6-N-propyl-2-N-thiophen-3-ylpyrazine-2,6-diamine.
| Compound Name | 6-N-propyl-2-N-thiophen-3-ylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80851429 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-N-propyl-2-N-thiophen-3-ylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(Nc2ccsc2)n1 |
| InChI | InChI=1S/C11H14N4S/c1-2-4-13-10-6-12-7-11(15-10)14-9-3-5-16-8-9/h3,5-8H,2,4H2,1H3,(H2,13,14,15) |
| InChIKey | UWUNJWSGYRIHOA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |