C8H13N3O — CID 80864998
5-methyl-4-propoxypyrimidin-2-amine (PubChem CID 80864998) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-methyl-4-propoxypyrimidin-2-amine.
| Compound Name | 5-methyl-4-propoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 80864998 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-methyl-4-propoxypyrimidin-2-amine |
| SMILES | CCCOc1nc(N)ncc1C |
| InChI | InChI=1S/C8H13N3O/c1-3-4-12-7-6(2)5-10-8(9)11-7/h5H,3-4H2,1-2H3,(H2,9,10,11) |
| InChIKey | ATWHJIIUXJUEGC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |