C11H16N4O — CID 80865039
8-butan-2-yloxy-N-methylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80865039) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 8-butan-2-yloxy-N-methylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-butan-2-yloxy-N-methylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80865039 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 8-butan-2-yloxy-N-methylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCC(C)Oc1nc(NC)cn2ccnc12 |
| InChI | InChI=1S/C11H16N4O/c1-4-8(2)16-11-10-13-5-6-15(10)7-9(12-3)14-11/h5-8,12H,4H2,1-3H3 |
| InChIKey | IPKYDEDBHIMMSB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |