C16H17N3O2 — CID 80865656
6-[[6-(ethylamino)-2-pyridinyl]oxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 80865656) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-[[6-(ethylamino)-2-pyridinyl]oxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[[6-(ethylamino)-2-pyridinyl]oxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 80865656 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 6-[[6-(ethylamino)-2-pyridinyl]oxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCNc1cccc(Oc2ccc3c(c2)CCC(=O)N3)n1 |
| InChI | InChI=1S/C16H17N3O2/c1-2-17-14-4-3-5-16(19-14)21-12-7-8-13-11(10-12)6-9-15(20)18-13/h3-5,7-8,10H,2,6,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | HNYTXGVSDNCMAH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |