C16H14BrN3O — CID 80866646
6-(1-bromonaphthalen-2-yl)oxy-N,2-dimethylpyrimidin-4-amine (PubChem CID 80866646) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 6-(1-bromonaphthalen-2-yl)oxy-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-(1-bromonaphthalen-2-yl)oxy-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80866646 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 6-(1-bromonaphthalen-2-yl)oxy-N,2-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(Oc2ccc3ccccc3c2Br)nc(C)n1 |
| InChI | InChI=1S/C16H14BrN3O/c1-10-19-14(18-2)9-15(20-10)21-13-8-7-11-5-3-4-6-12(11)16(13)17/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | OAXWBLGKQVEJAC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |