C13H9ClN4O — CID 80869028
4-chloro-6-naphthalen-1-yloxy-1,3,5-triazin-2-amine (PubChem CID 80869028) has the molecular formula C13H9ClN4O and a molecular weight of 272.70 g/mol. Its IUPAC name is 4-chloro-6-naphthalen-1-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-naphthalen-1-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80869028 |
| Molecular Formula | C13H9ClN4O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-chloro-6-naphthalen-1-yloxy-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(Oc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C13H9ClN4O/c14-11-16-12(15)18-13(17-11)19-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,15,16,17,18) |
| InChIKey | MZUXHVRJKBWIMT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |