C15H16N4O — CID 80869908
4-[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]oxybenzonitrile (PubChem CID 80869908) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]oxybenzonitrile.
| Compound Name | 4-[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 80869908 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]oxybenzonitrile |
| SMILES | CCNc1nc(C)nc(Oc2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C15H16N4O/c1-4-17-14-10(2)15(19-11(3)18-14)20-13-7-5-12(9-16)6-8-13/h5-8H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | AZTQHDVUPUATRM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |