C14H15Cl2N3O — CID 80875061
6-(3,5-dichlorophenoxy)-N-ethyl-2,5-dimethylpyrimidin-4-amine (PubChem CID 80875061) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 6-(3,5-dichlorophenoxy)-N-ethyl-2,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-(3,5-dichlorophenoxy)-N-ethyl-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80875061 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 6-(3,5-dichlorophenoxy)-N-ethyl-2,5-dimethylpyrimidin-4-amine |
| SMILES | CCNc1nc(C)nc(Oc2cc(Cl)cc(Cl)c2)c1C |
| InChI | InChI=1S/C14H15Cl2N3O/c1-4-17-13-8(2)14(19-9(3)18-13)20-12-6-10(15)5-11(16)7-12/h5-7H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | KIHXKQUSSZENQZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |