C14H20N4O2 — CID 80872799
8-(oxolan-3-ylmethoxy)-N-propylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80872799) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 8-(oxolan-3-ylmethoxy)-N-propylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(oxolan-3-ylmethoxy)-N-propylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80872799 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 8-(oxolan-3-ylmethoxy)-N-propylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCCNc1cn2ccnc2c(OCC2CCOC2)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-2-4-15-12-8-18-6-5-16-13(18)14(17-12)20-10-11-3-7-19-9-11/h5-6,8,11,15H,2-4,7,9-10H2,1H3 |
| InChIKey | PDJFJZBGQWRXDL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |