C13H19N5O — CID 80789191
6-N-ethyl-8-N-(oxan-4-yl)imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 80789191) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 6-N-ethyl-8-N-(oxan-4-yl)imidazo[1,2-a]pyrazine-6,8-diamine.
| Compound Name | 6-N-ethyl-8-N-(oxan-4-yl)imidazo[1,2-a]pyrazine-6,8-diamine |
|---|---|
| PubChem CID | 80789191 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 6-N-ethyl-8-N-(oxan-4-yl)imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CCNc1cn2ccnc2c(NC2CCOCC2)n1 |
| InChI | InChI=1S/C13H19N5O/c1-2-14-11-9-18-6-5-15-13(18)12(17-11)16-10-3-7-19-8-4-10/h5-6,9-10,14H,2-4,7-8H2,1H3,(H,16,17) |
| InChIKey | IDIWKTPBMJQQTD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |