C10H14N6O — CID 80926460
6-hydrazinyl-N-(oxolan-3-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80926460) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-hydrazinyl-N-(oxolan-3-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-(oxolan-3-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80926460 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 6-hydrazinyl-N-(oxolan-3-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(NC2CCOC2)n1 |
| InChI | InChI=1S/C10H14N6O/c11-15-8-5-16-3-2-12-10(16)9(14-8)13-7-1-4-17-6-7/h2-3,5,7,15H,1,4,6,11H2,(H,13,14) |
| InChIKey | XSFNXJFSVIQAON-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|