C13H20N6 — CID 80929758
N-(2,2-dimethylcyclopentyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80929758) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(2,2-dimethylcyclopentyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80929758 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC1(C)CCCC1Nc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C13H20N6/c1-13(2)5-3-4-9(13)16-11-12-15-6-7-19(12)8-10(17-11)18-14/h6-9,18H,3-5,14H2,1-2H3,(H,16,17) |
| InChIKey | CNOCJKYZDPIPFQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|