C14H22N6 — CID 80900774
6-hydrazinyl-N-methyl-N-(2-methylcyclohexyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80900774) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-(2-methylcyclohexyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-methyl-N-(2-methylcyclohexyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80900774 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-(2-methylcyclohexyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC1CCCCC1N(C)c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C14H22N6/c1-10-5-3-4-6-11(10)19(2)14-13-16-7-8-20(13)9-12(17-14)18-15/h7-11,18H,3-6,15H2,1-2H3 |
| InChIKey | WFSRLTHJJVSPAW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|