C12H18N6O — CID 80902724
6-hydrazinyl-N-(oxan-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80902724) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 6-hydrazinyl-N-(oxan-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-(oxan-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80902724 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-hydrazinyl-N-(oxan-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(NCC2CCCOC2)n1 |
| InChI | InChI=1S/C12H18N6O/c13-17-10-7-18-4-3-14-12(18)11(16-10)15-6-9-2-1-5-19-8-9/h3-4,7,9,17H,1-2,5-6,8,13H2,(H,15,16) |
| InChIKey | CEBMMCVNDJFDAB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|