C13H22N8 — CID 80907102
N-[(1,4-dimethylpiperazin-2-yl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80907102) has the molecular formula C13H22N8 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80907102 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CN1CCN(C)C(CNc2nc(NN)cn3ccnc23)C1 |
| InChI | InChI=1S/C13H22N8/c1-19-5-6-20(2)10(8-19)7-16-12-13-15-3-4-21(13)9-11(17-12)18-14/h3-4,9-10,18H,5-8,14H2,1-2H3,(H,16,17) |
| InChIKey | RKWRJOHYQIJDPA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|