C12H19N3O2 — CID 80872805
N,2,5-trimethyl-6-(oxolan-3-ylmethoxy)pyrimidin-4-amine (PubChem CID 80872805) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N,2,5-trimethyl-6-(oxolan-3-ylmethoxy)pyrimidin-4-amine.
| Compound Name | N,2,5-trimethyl-6-(oxolan-3-ylmethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80872805 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N,2,5-trimethyl-6-(oxolan-3-ylmethoxy)pyrimidin-4-amine |
| SMILES | CNc1nc(C)nc(OCC2CCOC2)c1C |
| InChI | InChI=1S/C12H19N3O2/c1-8-11(13-3)14-9(2)15-12(8)17-7-10-4-5-16-6-10/h10H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | FABHLMVBMFZDTL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |