C16H27N3O2 — CID 80991354
2-tert-butyl-N,5-dimethyl-6-(oxan-4-ylmethoxy)pyrimidin-4-amine (PubChem CID 80991354) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-tert-butyl-N,5-dimethyl-6-(oxan-4-ylmethoxy)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-N,5-dimethyl-6-(oxan-4-ylmethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80991354 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-tert-butyl-N,5-dimethyl-6-(oxan-4-ylmethoxy)pyrimidin-4-amine |
| SMILES | CNc1nc(C(C)(C)C)nc(OCC2CCOCC2)c1C |
| InChI | InChI=1S/C16H27N3O2/c1-11-13(17-5)18-15(16(2,3)4)19-14(11)21-10-12-6-8-20-9-7-12/h12H,6-10H2,1-5H3,(H,17,18,19) |
| InChIKey | AOKLHOWGDQJPLQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |