C12H21N5O2 — CID 80872901
2-N,2-N-diethyl-6-(oxan-4-yloxy)-1,3,5-triazine-2,4-diamine (PubChem CID 80872901) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-(oxan-4-yloxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-6-(oxan-4-yloxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80872901 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-N,2-N-diethyl-6-(oxan-4-yloxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(OC2CCOCC2)n1 |
| InChI | InChI=1S/C12H21N5O2/c1-3-17(4-2)11-14-10(13)15-12(16-11)19-9-5-7-18-8-6-9/h9H,3-8H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | DBMXKTJLNAMHJC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |