C15H18N2OS — CID 80880347
6-(2-methylsulfanylphenoxy)-N-propylpyridin-2-amine (PubChem CID 80880347) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 6-(2-methylsulfanylphenoxy)-N-propylpyridin-2-amine.
| Compound Name | 6-(2-methylsulfanylphenoxy)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 80880347 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-(2-methylsulfanylphenoxy)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(Oc2ccccc2SC)n1 |
| InChI | InChI=1S/C15H18N2OS/c1-3-11-16-14-9-6-10-15(17-14)18-12-7-4-5-8-13(12)19-2/h4-10H,3,11H2,1-2H3,(H,16,17) |
| InChIKey | OSRNFODKIYSEKI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |